C17H33N2O5P — CID 143084876
N-cyclopropyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phosphonamidous acid;ethene;ethyl formate (PubChem CID 143084876) has the molecular formula C17H33N2O5P and a molecular weight of 376.43 g/mol. Its IUPAC name is N-cyclopropyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phosphonamidous acid;ethene;ethyl formate.
| Compound Name | N-cyclopropyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phosphonamidous acid;ethene;ethyl formate |
|---|---|
| PubChem CID | 143084876 |
| Molecular Formula | C17H33N2O5P |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | N-cyclopropyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phosphonamidous acid;ethene;ethyl formate |
| SMILES | C=C.CC(C)(C)OC(=O)N1CCCC1P(O)NC1CC1.CCOC=O |
| InChI | InChI=1S/C12H23N2O3P.C3H6O2.C2H4/c1-12(2,3)17-11(15)14-8-4-5-10(14)18(16)13-9-6-7-9;1-2-5-3-4;1-2/h9-10,13,16H,4-8H2,1-3H3;3H,2H2,1H3;1-2H2 |
| InChIKey | USSNBDNKWIMVPJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|