C17H22N2 — CID 90995027
N-methyl-N-[2-methyl-1-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]penta-1,3-dienyl]cyclopropanamine (PubChem CID 90995027) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-methyl-N-[2-methyl-1-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]penta-1,3-dienyl]cyclopropanamine.
| Compound Name | N-methyl-N-[2-methyl-1-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]penta-1,3-dienyl]cyclopropanamine |
|---|---|
| PubChem CID | 90995027 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-methyl-N-[2-methyl-1-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]penta-1,3-dienyl]cyclopropanamine |
| SMILES | C=C1C=CC=CC1=NC(=C(C)C=CC)N(C)C1CC1 |
| InChI | InChI=1S/C17H22N2/c1-5-8-14(3)17(19(4)15-11-12-15)18-16-10-7-6-9-13(16)2/h5-10,15H,2,11-12H2,1,3-4H3 |
| InChIKey | UONFDNMMPDBRCY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|