C10H16N2 — CID 90904599
N-ethyl-N-methyl-3-[(1E)-2-methylbuta-1,3-dienyl]-2H-azirin-2-amine (PubChem CID 90904599) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-ethyl-N-methyl-3-[(1E)-2-methylbuta-1,3-dienyl]-2H-azirin-2-amine.
| Compound Name | N-ethyl-N-methyl-3-[(1E)-2-methylbuta-1,3-dienyl]-2H-azirin-2-amine |
|---|---|
| PubChem CID | 90904599 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-ethyl-N-methyl-3-[(1E)-2-methylbuta-1,3-dienyl]-2H-azirin-2-amine |
| SMILES | C=C/C(C)=C/C1=NC1N(C)CC |
| InChI | InChI=1S/C10H16N2/c1-5-8(3)7-9-10(11-9)12(4)6-2/h5,7,10H,1,6H2,2-4H3/b8-7+ |
| InChIKey | NVNLYBYZSGBVNV-BQYQJAHWSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|