C15H20N+ — CID 18692736
diethyl-[4-[(2E)-penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 18692736) has the molecular formula C15H20N+ and a molecular weight of 214.33 g/mol. Its IUPAC name is diethyl-[4-[(2E)-penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | diethyl-[4-[(2E)-penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 18692736 |
| Molecular Formula | C15H20N+ |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | diethyl-[4-[(2E)-penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | C=C/C=C/C=C1C=CC(=[N+](CC)CC)C=C1 |
| InChI | InChI=1S/C15H20N/c1-4-7-8-9-14-10-12-15(13-11-14)16(5-2)6-3/h4,7-13H,1,5-6H2,2-3H3/q+1/b8-7+ |
| InChIKey | JXZKZVXMGOCOEY-BQYQJAHWSA-N |
| XLogP | 3.27 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|