C9H11ClN+ — CID 59057615
(2-chloro-4-methylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium (PubChem CID 59057615) has the molecular formula C9H11ClN+ and a molecular weight of 168.65 g/mol. Its IUPAC name is (2-chloro-4-methylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium.
| Compound Name | (2-chloro-4-methylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium |
|---|---|
| PubChem CID | 59057615 |
| Molecular Formula | C9H11ClN+ |
| Molecular Weight | 168.65 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (2-chloro-4-methylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium |
| SMILES | C=C1C=CC(=[N+](C)C)C(Cl)=C1 |
| InChI | InChI=1S/C9H11ClN/c1-7-4-5-9(11(2)3)8(10)6-7/h4-6H,1H2,2-3H3/q+1 |
| InChIKey | MWRRAZZHAFSQMI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.65 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|