C8H8ClN — CID 123770500
3-chloro-N-methyl-6-methylidenecyclohexa-2,4-dien-1-imine (PubChem CID 123770500) has the molecular formula C8H8ClN and a molecular weight of 153.61 g/mol. Its IUPAC name is 3-chloro-N-methyl-6-methylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | 3-chloro-N-methyl-6-methylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123770500 |
| Molecular Formula | C8H8ClN |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 3-chloro-N-methyl-6-methylidenecyclohexa-2,4-dien-1-imine |
| SMILES | C=C1C=CC(Cl)=C/C1=N\C |
| InChI | InChI=1S/C8H8ClN/c1-6-3-4-7(9)5-8(6)10-2/h3-5H,1H2,2H3/b10-8+ |
| InChIKey | GSMVDDTUHFCCMQ-CSKARUKUSA-N |
| XLogP | 2.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|