C10H14ClN2+ — CID 123432956
(4-chloro-6-methyliminocyclohexa-2,4-dien-1-ylidene)-ethyl-methylazanium (PubChem CID 123432956) has the molecular formula C10H14ClN2+ and a molecular weight of 197.69 g/mol. Its IUPAC name is (4-chloro-6-methyliminocyclohexa-2,4-dien-1-ylidene)-ethyl-methylazanium.
| Compound Name | (4-chloro-6-methyliminocyclohexa-2,4-dien-1-ylidene)-ethyl-methylazanium |
|---|---|
| PubChem CID | 123432956 |
| Molecular Formula | C10H14ClN2+ |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (4-chloro-6-methyliminocyclohexa-2,4-dien-1-ylidene)-ethyl-methylazanium |
| SMILES | CC/[N+](C)=C1\C=CC(Cl)=C\C1=N/C |
| InChI | InChI=1S/C10H14ClN2/c1-4-13(3)10-6-5-8(11)7-9(10)12-2/h5-7H,4H2,1-3H3/q+1/b12-9+,13-10+ |
| InChIKey | MNTQBZCWLBZTHF-JOWSBRCASA-N |
| XLogP | 1.85 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|