C12H18N2+2 — CID 123257336
1,6-dimethyl-2,3,4,5-tetrahydro-1,6-benzodiazocine-1,6-diium (PubChem CID 123257336) has the molecular formula C12H18N2+2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1,6-dimethyl-2,3,4,5-tetrahydro-1,6-benzodiazocine-1,6-diium.
| Compound Name | 1,6-dimethyl-2,3,4,5-tetrahydro-1,6-benzodiazocine-1,6-diium |
|---|---|
| PubChem CID | 123257336 |
| Molecular Formula | C12H18N2+2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1,6-dimethyl-2,3,4,5-tetrahydro-1,6-benzodiazocine-1,6-diium |
| SMILES | C/[N+]1=c2\cccc\c2=[N+](/C)CCCC1 |
| InChI | InChI=1S/C12H18N2/c1-13-9-5-6-10-14(2)12-8-4-3-7-11(12)13/h3-4,7-8H,5-6,9-10H2,1-2H3/q+2/b13-11-,14-12- |
| InChIKey | WJGWIXDBSNDHJG-XSYHWHKQSA-N |
| XLogP | -0.28 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|