C12H17N2+ — CID 91803313
2-ethyl-1-methyl-3,9-dihydro-2H-cyclohepta[b]pyrazin-1-ium (PubChem CID 91803313) has the molecular formula C12H17N2+ and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-ethyl-1-methyl-3,9-dihydro-2H-cyclohepta[b]pyrazin-1-ium.
| Compound Name | 2-ethyl-1-methyl-3,9-dihydro-2H-cyclohepta[b]pyrazin-1-ium |
|---|---|
| PubChem CID | 91803313 |
| Molecular Formula | C12H17N2+ |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 2-ethyl-1-methyl-3,9-dihydro-2H-cyclohepta[b]pyrazin-1-ium |
| SMILES | CCC1CN=C2C=CC=CCC2=[N+]1C |
| InChI | InChI=1S/C12H17N2/c1-3-10-9-13-11-7-5-4-6-8-12(11)14(10)2/h4-7,10H,3,8-9H2,1-2H3/q+1 |
| InChIKey | JJJBQFNYLSHUER-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|