C13H13N2+ — CID 164787087
5-methyl-4a,10a-dihydrophenazin-5-ium (PubChem CID 164787087) has the molecular formula C13H13N2+ and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-methyl-4a,10a-dihydrophenazin-5-ium.
| Compound Name | 5-methyl-4a,10a-dihydrophenazin-5-ium |
|---|---|
| PubChem CID | 164787087 |
| Molecular Formula | C13H13N2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 5-methyl-4a,10a-dihydrophenazin-5-ium |
| SMILES | C[N+]1=c2ccccc2=NC2C=CC=CC21 |
| InChI | InChI=1S/C13H13N2/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15/h2-10,12H,1H3/q+1 |
| InChIKey | DLFRSKUEWVIWTN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|