C12H12N+ — CID 140836254
13-azoniatricyclo[7.3.1.05,13]trideca-1,3,6,9(13),10-pentaene (PubChem CID 140836254) has the molecular formula C12H12N+ and a molecular weight of 170.24 g/mol. Its IUPAC name is 13-azoniatricyclo[7.3.1.05,13]trideca-1,3,6,9(13),10-pentaene.
| Compound Name | 13-azoniatricyclo[7.3.1.05,13]trideca-1,3,6,9(13),10-pentaene |
|---|---|
| PubChem CID | 140836254 |
| Molecular Formula | C12H12N+ |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.10 |
| IUPAC Name | 13-azoniatricyclo[7.3.1.05,13]trideca-1,3,6,9(13),10-pentaene |
| SMILES | C1=CC2C=CCC3=[N+]2C(=C1)CC=C3 |
| InChI | InChI=1S/C12H12N/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12/h1-6,9-10H,7-8H2/q+1 |
| InChIKey | LJJUHVPJNAVDRP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|