C17H14N+ — CID 57038467
6,9b-dihydropyrido[1,2-f]phenanthridin-5-ium (PubChem CID 57038467) has the molecular formula C17H14N+ and a molecular weight of 232.31 g/mol. Its IUPAC name is 6,9b-dihydropyrido[1,2-f]phenanthridin-5-ium.
| Compound Name | 6,9b-dihydropyrido[1,2-f]phenanthridin-5-ium |
|---|---|
| PubChem CID | 57038467 |
| Molecular Formula | C17H14N+ |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 6,9b-dihydropyrido[1,2-f]phenanthridin-5-ium |
| SMILES | C1=CC[N+]2=c3ccccc3=C3C=CC=CC3C2=C1 |
| InChI | InChI=1S/C17H14N/c1-2-8-14-13(7-1)15-9-3-4-10-16(15)18-12-6-5-11-17(14)18/h1-11,14H,12H2/q+1 |
| InChIKey | UWIFWEWYHQLKGG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|