C11H14N+ — CID 89324226
1,2-dimethyl-2,3-dihydroquinolin-1-ium (PubChem CID 89324226) has the molecular formula C11H14N+ and a molecular weight of 160.24 g/mol. Its IUPAC name is 1,2-dimethyl-2,3-dihydroquinolin-1-ium.
| Compound Name | 1,2-dimethyl-2,3-dihydroquinolin-1-ium |
|---|---|
| PubChem CID | 89324226 |
| Molecular Formula | C11H14N+ |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 1,2-dimethyl-2,3-dihydroquinolin-1-ium |
| SMILES | CC1CC=c2ccccc2=[N+]1C |
| InChI | InChI=1S/C11H14N/c1-9-7-8-10-5-3-4-6-11(10)12(9)2/h3-6,8-9H,7H2,1-2H3/q+1 |
| InChIKey | YFCMFHMOAZLSTM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|