C15H24N+ — CID 143983051
dibutyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 143983051) has the molecular formula C15H24N+ and a molecular weight of 218.36 g/mol. Its IUPAC name is dibutyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium.
| Compound Name | dibutyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 143983051 |
| Molecular Formula | C15H24N+ |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | dibutyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | C=C1C=CC(=[N+](CCCC)CCCC)C=C1 |
| InChI | InChI=1S/C15H24N/c1-4-6-12-16(13-7-5-2)15-10-8-14(3)9-11-15/h8-11H,3-7,12-13H2,1-2H3/q+1 |
| InChIKey | FGFDQZZBPPDVQH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|