About 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine
3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine (PubChem CID 91204887) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine.
Analyze 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine?
The IUPAC name of 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine (CID 91204887) is 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine.
What is the SMILES notation for 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine?
The canonical SMILES for 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine is CCC(C)=C(C)C=C1C=CC(C)=NC1.
What is the InChIKey of 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine?
The InChIKey is NEVFZZKQGYUATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-5-10(2)11(3)8-13-7-6-12(4)14-9-13/h6-8H,5,9H2,1-4H3.
What are the key properties of 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine?
3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine has a molecular weight of 189.30 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylpent-2-enylidene)-6-methyl-2H-pyridine is sourced from PubChem (CID 91204887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).