C24H40F10O5Si2 — CID 90997935
3,3-difluoro-4-methyl-2-(trifluoromethyl)-4-(2-trimethylsilylethoxy)oxolan-2-ol;3,3-difluoro-2-(trifluoromethyl)-3a-(2-trimethylsilylethyl)-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-ol (PubChem CID 90997935) has the molecular formula C24H40F10O5Si2 and a molecular weight of 654.73 g/mol. Its IUPAC name is 3,3-difluoro-4-methyl-2-(trifluoromethyl)-4-(2-trimethylsilylethoxy)oxolan-2-ol;3,3-difluoro-2-(trifluoromethyl)-3a-(2-trimethylsilylethyl)-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-ol.
| Compound Name | 3,3-difluoro-4-methyl-2-(trifluoromethyl)-4-(2-trimethylsilylethoxy)oxolan-2-ol;3,3-difluoro-2-(trifluoromethyl)-3a-(2-trimethylsilylethyl)-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 90997935 |
| Molecular Formula | C24H40F10O5Si2 |
| Molecular Weight | 654.73 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | 3,3-difluoro-4-methyl-2-(trifluoromethyl)-4-(2-trimethylsilylethoxy)oxolan-2-ol;3,3-difluoro-2-(trifluoromethyl)-3a-(2-trimethylsilylethyl)-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-ol |
| SMILES | CC1(OCC[Si](C)(C)C)COC(O)(C(F)(F)F)C1(F)F.C[Si](C)(C)CCC12CCCC1OC(O)(C(F)(F)F)C2(F)F |
| InChI | InChI=1S/C13H21F5O2Si.C11H19F5O3Si/c1-21(2,3)8-7-10-6-4-5-9(10)20-12(19,11(10,14)15)13(16,17)18;1-8(18-5-6-20(2,3)4)7-19-10(17,9(8,12)13)11(14,15)16/h9,19H,4-8H2,1-3H3;17H,5-7H2,1-4H3 |
| InChIKey | QXVGDZNXBXDBAC-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|