C26H34N6O4 — CID 90998031
tert-butyl N-[4-[hydroxy(3-phenylpropyl)carbamoyl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]carbamate (PubChem CID 90998031) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is tert-butyl N-[4-[hydroxy(3-phenylpropyl)carbamoyl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[4-[hydroxy(3-phenylpropyl)carbamoyl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 90998031 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | tert-butyl N-[4-[hydroxy(3-phenylpropyl)carbamoyl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)N(O)CCCc2ccccc2)CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C26H34N6O4/c1-25(2,3)36-24(34)30-26(23(33)32(35)15-7-10-19-8-5-4-6-9-19)12-16-31(17-13-26)22-20-11-14-27-21(20)28-18-29-22/h4-6,8-9,11,14,18,35H,7,10,12-13,15-17H2,1-3H3,(H,30,34)(H,27,28,29) |
| InChIKey | IMLFLLUOTLHXQI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|