C29H34N8O4 — CID 59279196
tert-butyl N-[4-[(2-amino-6-phenylmethoxyphenyl)carbamoyl]-1-(7H-purin-6-yl)piperidin-4-yl]carbamate (PubChem CID 59279196) has the molecular formula C29H34N8O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-amino-6-phenylmethoxyphenyl)carbamoyl]-1-(7H-purin-6-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-amino-6-phenylmethoxyphenyl)carbamoyl]-1-(7H-purin-6-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 59279196 |
| Molecular Formula | C29H34N8O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | tert-butyl N-[4-[(2-amino-6-phenylmethoxyphenyl)carbamoyl]-1-(7H-purin-6-yl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)Nc2c(N)cccc2OCc2ccccc2)CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C29H34N8O4/c1-28(2,3)41-27(39)36-29(12-14-37(15-13-29)25-23-24(32-17-31-23)33-18-34-25)26(38)35-22-20(30)10-7-11-21(22)40-16-19-8-5-4-6-9-19/h4-11,17-18H,12-16,30H2,1-3H3,(H,35,38)(H,36,39)(H,31,32,33,34) |
| InChIKey | CPUKKQIMWOZDFW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 160.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|