C16H22O8S — CID 90998853
[(5S,7R,8S,9S)-8,9-dihydroxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl]methyl 4-methylbenzenesulfonate (PubChem CID 90998853) has the molecular formula C16H22O8S and a molecular weight of 374.41 g/mol. Its IUPAC name is [(5S,7R,8S,9S)-8,9-dihydroxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(5S,7R,8S,9S)-8,9-dihydroxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90998853 |
| Molecular Formula | C16H22O8S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [(5S,7R,8S,9S)-8,9-dihydroxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@]3(COC(C)(C)O3)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H22O8S/c1-10-4-6-11(7-5-10)25(19,20)22-8-12-13(17)14(18)16(23-12)9-21-15(2,3)24-16/h4-7,12-14,17-18H,8-9H2,1-3H3/t12-,13-,14+,16+/m1/s1 |
| InChIKey | MMUXVZRFTWZNRW-NYTXWWLZSA-N |
| XLogP | 0.30 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|