C17H32NOP — CID 90998909
dibutyl-butylimino-cyclopenta-1,3-dien-1-yloxy-λ5-phosphane (PubChem CID 90998909) has the molecular formula C17H32NOP and a molecular weight of 297.42 g/mol. Its IUPAC name is dibutyl-butylimino-cyclopenta-1,3-dien-1-yloxy-λ5-phosphane.
| Compound Name | dibutyl-butylimino-cyclopenta-1,3-dien-1-yloxy-λ5-phosphane |
|---|---|
| PubChem CID | 90998909 |
| Molecular Formula | C17H32NOP |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | dibutyl-butylimino-cyclopenta-1,3-dien-1-yloxy-λ5-phosphane |
| SMILES | CCCCN=P(CCCC)(CCCC)OC1=CC=CC1 |
| InChI | InChI=1S/C17H32NOP/c1-4-7-14-18-20(15-8-5-2,16-9-6-3)19-17-12-10-11-13-17/h10-12H,4-9,13-16H2,1-3H3 |
| InChIKey | ZLPICNZFPAZZJE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|