C23H44NOP — CID 90749341
cyclopenta-1,3-dien-1-yloxy-bis(4-methylpentyl)-(4-methylpentylimino)-λ5-phosphane (PubChem CID 90749341) has the molecular formula C23H44NOP and a molecular weight of 381.59 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yloxy-bis(4-methylpentyl)-(4-methylpentylimino)-λ5-phosphane.
| Compound Name | cyclopenta-1,3-dien-1-yloxy-bis(4-methylpentyl)-(4-methylpentylimino)-λ5-phosphane |
|---|---|
| PubChem CID | 90749341 |
| Molecular Formula | C23H44NOP |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | cyclopenta-1,3-dien-1-yloxy-bis(4-methylpentyl)-(4-methylpentylimino)-λ5-phosphane |
| SMILES | CC(C)CCCN=P(CCCC(C)C)(CCCC(C)C)OC1=CC=CC1 |
| InChI | InChI=1S/C23H44NOP/c1-20(2)12-9-17-24-26(18-10-13-21(3)4,19-11-14-22(5)6)25-23-15-7-8-16-23/h7-8,15,20-22H,9-14,16-19H2,1-6H3 |
| InChIKey | JIIFPUWGVRIFJM-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|