C17H28 — CID 123240339
1-(9-methyldecyl)-5-methylidenecyclopenta-1,3-diene (PubChem CID 123240339) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 1-(9-methyldecyl)-5-methylidenecyclopenta-1,3-diene.
| Compound Name | 1-(9-methyldecyl)-5-methylidenecyclopenta-1,3-diene |
|---|---|
| PubChem CID | 123240339 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1-(9-methyldecyl)-5-methylidenecyclopenta-1,3-diene |
| SMILES | C=C1C=CC=C1CCCCCCCCC(C)C |
| InChI | InChI=1S/C17H28/c1-15(2)11-8-6-4-5-7-9-13-17-14-10-12-16(17)3/h10,12,14-15H,3-9,11,13H2,1-2H3 |
| InChIKey | ZBOICBGEWWBEEW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|