C24H44O — CID 163529899
1,4-bis(7-methyloctyl)cyclohexa-2,4-dien-1-ol (PubChem CID 163529899) has the molecular formula C24H44O and a molecular weight of 348.62 g/mol. Its IUPAC name is 1,4-bis(7-methyloctyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1,4-bis(7-methyloctyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 163529899 |
| Molecular Formula | C24H44O |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.34 |
| IUPAC Name | 1,4-bis(7-methyloctyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)CCCCCCC1=CCC(O)(CCCCCCC(C)C)C=C1 |
| InChI | InChI=1S/C24H44O/c1-21(2)13-9-5-6-11-15-23-16-19-24(25,20-17-23)18-12-8-7-10-14-22(3)4/h16-17,19,21-22,25H,5-15,18,20H2,1-4H3 |
| InChIKey | DSAXSXCDJBQSOE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|