About 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane
2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane (PubChem CID 91001186) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane.
Analyze 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane?
The IUPAC name of 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane (CID 91001186) is 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane.
What is the SMILES notation for 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane?
The canonical SMILES for 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane is CC(C)C1C23CC12C(C)(C)C3C.
What is the InChIKey of 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane?
The InChIKey is YAHDATLTMOCLIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-7(2)9-11-6-12(9,11)10(4,5)8(11)3/h7-9H,6H2,1-5H3.
What are the key properties of 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane?
2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane has a molecular weight of 164.29 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-trimethyl-5-propan-2-yltricyclo[2.1.1.01,4]hexane is sourced from PubChem (CID 91001186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).