C29H37N7O8 — CID 91002799
tert-butyl N-[(5aR,6aS,7S,10aS)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1-hydroxy-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]carbamate (PubChem CID 91002799) has the molecular formula C29H37N7O8 and a molecular weight of 611.66 g/mol. Its IUPAC name is tert-butyl N-[(5aR,6aS,7S,10aS)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1-hydroxy-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]carbamate.
| Compound Name | tert-butyl N-[(5aR,6aS,7S,10aS)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1-hydroxy-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 91002799 |
| Molecular Formula | C29H37N7O8 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | tert-butyl N-[(5aR,6aS,7S,10aS)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1-hydroxy-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]carbamate |
| SMILES | CN(C)c1cc(NC(=O)OC(C)(C)C)c(O)c2c1C[C@@]1(N)C[C@@]3(N)[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(C#N)C(=O)C1C2=O |
| InChI | InChI=1S/C29H37N7O8/c1-26(2,3)44-25(43)34-13-8-14(35(4)5)12-9-27(32)10-29(33)21(36(6)7)20(39)16(24(31)42)22(40)28(29,11-30)23(41)17(27)19(38)15(12)18(13)37/h8,16-17,21,37H,9-10,32-33H2,1-7H3,(H2,31,42)(H,34,43)/t16?,17?,21-,27-,28+,29-/m1/s1 |
| InChIKey | LZXUHCYTGNXWFB-QAIYHCMLSA-N |
| XLogP | -0.78 |
| TPSA | 252.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|