C24H27N5O6 — CID 91005819
(4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-ethyl-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide (PubChem CID 91005819) has the molecular formula C24H27N5O6 and a molecular weight of 481.51 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-ethyl-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-ethyl-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91005819 |
| Molecular Formula | C24H27N5O6 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-ethyl-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
| SMILES | CCc1ccc(O)c2c1C[C@@]1(N)C[C@@]3(N)[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(C#N)C(=O)C1C2=O |
| InChI | InChI=1S/C24H27N5O6/c1-4-10-5-6-12(30)13-11(10)7-22(27)8-24(28)18(29(2)3)17(32)14(21(26)35)19(33)23(24,9-25)20(34)15(22)16(13)31/h5-6,14-15,18,30H,4,7-8,27-28H2,1-3H3,(H2,26,35)/t14?,15?,18-,22-,23+,24-/m1/s1 |
| InChIKey | ZOLOVKIOJSZLLM-VWKQJVLTSA-N |
| XLogP | -1.63 |
| TPSA | 210.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|