C30H30N6O8 — CID 91178648
methyl 3-[(6aS,10S,10aS,11aR)-10a,11a-diamino-8-carbamoyl-6a-cyano-10-(dimethylamino)-4-hydroxy-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-5-aminobenzoate (PubChem CID 91178648) has the molecular formula C30H30N6O8 and a molecular weight of 602.60 g/mol. Its IUPAC name is methyl 3-[(6aS,10S,10aS,11aR)-10a,11a-diamino-8-carbamoyl-6a-cyano-10-(dimethylamino)-4-hydroxy-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-5-aminobenzoate.
| Compound Name | methyl 3-[(6aS,10S,10aS,11aR)-10a,11a-diamino-8-carbamoyl-6a-cyano-10-(dimethylamino)-4-hydroxy-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-5-aminobenzoate |
|---|---|
| PubChem CID | 91178648 |
| Molecular Formula | C30H30N6O8 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | methyl 3-[(6aS,10S,10aS,11aR)-10a,11a-diamino-8-carbamoyl-6a-cyano-10-(dimethylamino)-4-hydroxy-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-5-aminobenzoate |
| SMILES | COC(=O)c1cc(N)cc(-c2ccc(O)c3c2C[C@@]2(N)C[C@@]4(N)[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(C#N)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C30H30N6O8/c1-36(2)23-22(39)19(26(33)42)24(40)29(11-31)25(41)20-21(38)18-16(9-28(20,34)10-30(23,29)35)15(4-5-17(18)37)12-6-13(27(43)44-3)8-14(32)7-12/h4-8,19-20,23,37H,9-10,32,34-35H2,1-3H3,(H2,33,42)/t19?,20?,23-,28-,29+,30-/m1/s1 |
| InChIKey | TWPMISVWVUARDI-LVGCWQEVSA-N |
| XLogP | -1.16 |
| TPSA | 262.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|