C30H31N5O8 — CID 91517804
(4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-7-(2,4-dimethoxyphenyl)-4-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide (PubChem CID 91517804) has the molecular formula C30H31N5O8 and a molecular weight of 589.61 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-7-(2,4-dimethoxyphenyl)-4-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-7-(2,4-dimethoxyphenyl)-4-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91517804 |
| Molecular Formula | C30H31N5O8 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4a,5a-diamino-12a-cyano-7-(2,4-dimethoxyphenyl)-4-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(O)c3c2C[C@@]2(N)C[C@@]4(N)[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(C#N)C(=O)C2C3=O)c(OC)c1 |
| InChI | InChI=1S/C30H31N5O8/c1-35(2)24-23(38)20(27(32)41)25(39)29(12-31)26(40)21-22(37)19-16(10-28(21,33)11-30(24,29)34)14(7-8-17(19)36)15-6-5-13(42-3)9-18(15)43-4/h5-9,20-21,24,36H,10-11,33-34H2,1-4H3,(H2,32,41)/t20?,21?,24-,28-,29+,30-/m1/s1 |
| InChIKey | VMRFEZXIPOPLKW-UUCSKNCRSA-N |
| XLogP | -0.51 |
| TPSA | 229.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|