C24H29N3O9S — CID 91131244
(4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-(methanesulfonamido)-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide (PubChem CID 91131244) has the molecular formula C24H29N3O9S and a molecular weight of 535.58 g/mol. Its IUPAC name is (4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-(methanesulfonamido)-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-(methanesulfonamido)-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91131244 |
| Molecular Formula | C24H29N3O9S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-(methanesulfonamido)-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(NS(C)(=O)=O)c4C[C@@]3(C)C[C@@]12C |
| InChI | InChI=1S/C24H29N3O9S/c1-22-8-10-11(26-37(5,35)36)6-7-12(28)13(10)16(29)15(22)20(32)24(34)19(31)14(21(25)33)17(30)18(27(3)4)23(24,2)9-22/h6-7,14-15,18,26,28,34H,8-9H2,1-5H3,(H2,25,33)/t14?,15?,18-,22+,23+,24-/m1/s1 |
| InChIKey | FWEYRBJYYZWDNG-CXPAYIQDSA-N |
| XLogP | -0.98 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|