C32H36N2O8 — CID 91524248
(4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[2-(3-methoxyphenyl)ethyl]-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide (PubChem CID 91524248) has the molecular formula C32H36N2O8 and a molecular weight of 576.65 g/mol. Its IUPAC name is (4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[2-(3-methoxyphenyl)ethyl]-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[2-(3-methoxyphenyl)ethyl]-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91524248 |
| Molecular Formula | C32H36N2O8 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | (4S,4aS,5aS,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[2-(3-methoxyphenyl)ethyl]-4a,5a-dimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
| SMILES | COc1cccc(CCc2ccc(O)c3c2C[C@@]2(C)C[C@@]4(C)[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C32H36N2O8/c1-30-14-19-17(10-9-16-7-6-8-18(13-16)42-5)11-12-20(35)21(19)24(36)23(30)28(39)32(41)27(38)22(29(33)40)25(37)26(34(3)4)31(32,2)15-30/h6-8,11-13,22-23,26,35,41H,9-10,14-15H2,1-5H3,(H2,33,40)/t22?,23?,26-,30+,31+,32-/m1/s1 |
| InChIKey | QFDSJUDQPHEKPV-KVQXARTBSA-N |
| XLogP | 1.44 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|