C39H42O7 — CID 123766650
(4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(2-methylpropyl)naphthalen-1-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123766650) has the molecular formula C39H42O7 and a molecular weight of 622.76 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(2-methylpropyl)naphthalen-1-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(2-methylpropyl)naphthalen-1-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123766650 |
| Molecular Formula | C39H42O7 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(2-methylpropyl)naphthalen-1-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)C[C@@]3(C)Cc4c(-c5ccc(CC(C)C)c6ccccc56)ccc(O)c4C(=O)C3C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C39H42O7/c1-19(2)16-22-12-13-25(24-11-9-8-10-23(22)24)26-14-15-28(41)30-27(26)17-37(6)18-38(7)31(20(3)4)33(42)29(21(5)40)35(44)39(38,46)36(45)32(37)34(30)43/h8-15,19-20,29,31-32,41,46H,16-18H2,1-7H3/t29?,31?,32?,37-,38-,39+/m1/s1 |
| InChIKey | SZOLKZZCQXOWDR-NZRXDQMRSA-N |
| XLogP | 6.11 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|