C38H44O8 — CID 123196303
(4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(5-methyl-2-oxohexyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123196303) has the molecular formula C38H44O8 and a molecular weight of 628.76 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(5-methyl-2-oxohexyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(5-methyl-2-oxohexyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123196303 |
| Molecular Formula | C38H44O8 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[4-(5-methyl-2-oxohexyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)C[C@@]3(C)Cc4c(-c5ccc(CC(=O)CCC(C)C)cc5)ccc(O)c4C(=O)C3C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C38H44O8/c1-19(2)8-13-24(40)16-22-9-11-23(12-10-22)25-14-15-27(41)29-26(25)17-36(6)18-37(7)30(20(3)4)32(42)28(21(5)39)34(44)38(37,46)35(45)31(36)33(29)43/h9-12,14-15,19-20,28,30-31,41,46H,8,13,16-18H2,1-7H3/t28?,30?,31?,36-,37-,38+/m1/s1 |
| InChIKey | ORKOBQWEXKOSKR-IYQLPWQRSA-N |
| XLogP | 5.31 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|