C37H40O7 — CID 123266248
(4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-[(E)-3-methylidenepent-1-enyl]phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123266248) has the molecular formula C37H40O7 and a molecular weight of 596.72 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-[(E)-3-methylidenepent-1-enyl]phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-[(E)-3-methylidenepent-1-enyl]phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123266248 |
| Molecular Formula | C37H40O7 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-[(E)-3-methylidenepent-1-enyl]phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | C=C(/C=C/c1cccc(-c2ccc(O)c3c2C[C@]2(C)C[C@]4(C)C(C(C)C)C(=O)C(C(C)=O)C(=O)[C@]4(O)C(=O)C2C3=O)c1)CC |
| InChI | InChI=1S/C37H40O7/c1-8-20(4)12-13-22-10-9-11-23(16-22)24-14-15-26(39)28-25(24)17-35(6)18-36(7)29(19(2)3)31(40)27(21(5)38)33(42)37(36,44)34(43)30(35)32(28)41/h9-16,19,27,29-30,39,44H,4,8,17-18H2,1-3,5-7H3/b13-12+/t27?,29?,30?,35-,36-,37+/m1/s1 |
| InChIKey | RKNGNXGNLOBYEX-BZZWWSRCSA-N |
| XLogP | 5.74 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|