C33H42O8 — CID 123737829
(4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-9-(2-oxopentyl)-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123737829) has the molecular formula C33H42O8 and a molecular weight of 566.69 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-9-(2-oxopentyl)-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-9-(2-oxopentyl)-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123737829 |
| Molecular Formula | C33H42O8 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-9-(2-oxopentyl)-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CCCC(=O)Cc1cc(C(C)C)c2c(c1O)C(=O)C1C(=O)[C@@]3(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]3(C)C[C@@]1(C)C2 |
| InChI | InChI=1S/C33H42O8/c1-9-10-19(35)11-18-12-20(15(2)3)21-13-31(7)14-32(8)24(16(4)5)27(37)22(17(6)34)29(39)33(32,41)30(40)25(31)28(38)23(21)26(18)36/h12,15-16,22,24-25,36,41H,9-11,13-14H2,1-8H3/t22?,24?,25?,31-,32-,33+/m1/s1 |
| InChIKey | FUSLYOKBKOILPI-AABYGHKZSA-N |
| XLogP | 4.13 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|