C38H46O9 — CID 123641282
ethyl 4-[2-[(5aR,6aR,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-4,7-di(propan-2-yl)-5,6,7,11a-tetrahydrotetracen-2-yl]ethyl]cyclopenta-1,4-diene-1-carboxylate (PubChem CID 123641282) has the molecular formula C38H46O9 and a molecular weight of 646.78 g/mol. Its IUPAC name is ethyl 4-[2-[(5aR,6aR,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-4,7-di(propan-2-yl)-5,6,7,11a-tetrahydrotetracen-2-yl]ethyl]cyclopenta-1,4-diene-1-carboxylate.
| Compound Name | ethyl 4-[2-[(5aR,6aR,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-4,7-di(propan-2-yl)-5,6,7,11a-tetrahydrotetracen-2-yl]ethyl]cyclopenta-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 123641282 |
| Molecular Formula | C38H46O9 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | ethyl 4-[2-[(5aR,6aR,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-4,7-di(propan-2-yl)-5,6,7,11a-tetrahydrotetracen-2-yl]ethyl]cyclopenta-1,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC(CCc2cc(C(C)C)c3c(c2O)C(=O)C2C(=O)[C@@]4(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]4(C)C[C@@]2(C)C3)=C1 |
| InChI | InChI=1S/C38H46O9/c1-9-47-35(45)23-13-11-21(14-23)10-12-22-15-24(18(2)3)25-16-36(7)17-37(8)28(19(4)5)31(41)26(20(6)39)33(43)38(37,46)34(44)29(36)32(42)27(25)30(22)40/h13-15,18-19,26,28-29,40,46H,9-12,16-17H2,1-8H3/t26?,28?,29?,36-,37-,38+/m1/s1 |
| InChIKey | KAHMIFIRYWHMGU-ZXFKPRMZSA-N |
| XLogP | 4.97 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|