C32H42O7 — CID 123960414
(4aR,5aR,12aR)-2-acetyl-9-(4,4-dimethylpentyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123960414) has the molecular formula C32H42O7 and a molecular weight of 538.68 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-9-(4,4-dimethylpentyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-9-(4,4-dimethylpentyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123960414 |
| Molecular Formula | C32H42O7 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-9-(4,4-dimethylpentyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)C[C@@]3(C)Cc4ccc(CCCC(C)(C)C)c(O)c4C(=O)C3C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C32H42O7/c1-16(2)22-25(35)20(17(3)33)27(37)32(39)28(38)23-26(36)21-19(14-30(23,7)15-31(22,32)8)12-11-18(24(21)34)10-9-13-29(4,5)6/h11-12,16,20,22-23,34,39H,9-10,13-15H2,1-8H3/t20?,22?,23?,30-,31-,32+/m1/s1 |
| InChIKey | YXGNTLBSWXHWDT-ZEKYUDQPSA-N |
| XLogP | 4.46 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|