C31H36O8 — CID 123776330
(4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[(Z)-5-oxohex-2-en-2-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123776330) has the molecular formula C31H36O8 and a molecular weight of 536.62 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[(Z)-5-oxohex-2-en-2-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[(Z)-5-oxohex-2-en-2-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123776330 |
| Molecular Formula | C31H36O8 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[(Z)-5-oxohex-2-en-2-yl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C/C=C(/C)c1ccc(O)c2c1C[C@]1(C)C[C@]3(C)C(C(C)C)C(=O)C(C(C)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H36O8/c1-14(2)23-25(35)21(17(5)33)27(37)31(39)28(38)24-26(36)22-19(12-29(24,6)13-30(23,31)7)18(10-11-20(22)34)15(3)8-9-16(4)32/h8,10-11,14,21,23-24,34,39H,9,12-13H2,1-7H3/b15-8-/t21?,23?,24?,29-,30-,31+/m1/s1 |
| InChIKey | LEJKCGXZRWQRTN-CJSBVQFLSA-N |
| XLogP | 3.48 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|