C37H42O8 — CID 123307603
(4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-(oxan-4-ylmethyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123307603) has the molecular formula C37H42O8 and a molecular weight of 614.74 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-(oxan-4-ylmethyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-(oxan-4-ylmethyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123307603 |
| Molecular Formula | C37H42O8 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-10,12a-dihydroxy-4a,5a-dimethyl-7-[3-(oxan-4-ylmethyl)phenyl]-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)C[C@@]3(C)Cc4c(-c5cccc(CC6CCOCC6)c5)ccc(O)c4C(=O)C3C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C37H42O8/c1-19(2)29-31(40)27(20(3)38)33(42)37(44)34(43)30-32(41)28-25(17-35(30,4)18-36(29,37)5)24(9-10-26(28)39)23-8-6-7-22(16-23)15-21-11-13-45-14-12-21/h6-10,16,19,21,27,29-30,39,44H,11-15,17-18H2,1-5H3/t27?,29?,30?,35-,36-,37+/m1/s1 |
| InChIKey | VDOZZUGCPKSTQA-PBDGPXKNSA-N |
| XLogP | 4.73 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|