C39H46O7 — CID 123592779
(4aR,5aR,12aR)-2-acetyl-7-[4-(4,4-dimethyl-2-methylidenepentyl)phenyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123592779) has the molecular formula C39H46O7 and a molecular weight of 626.79 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-7-[4-(4,4-dimethyl-2-methylidenepentyl)phenyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-7-[4-(4,4-dimethyl-2-methylidenepentyl)phenyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123592779 |
| Molecular Formula | C39H46O7 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-7-[4-(4,4-dimethyl-2-methylidenepentyl)phenyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | C=C(Cc1ccc(-c2ccc(O)c3c2C[C@]2(C)C[C@]4(C)C(C(C)C)C(=O)C(C(C)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1)CC(C)(C)C |
| InChI | InChI=1S/C39H46O7/c1-20(2)30-32(42)28(22(4)40)34(44)39(46)35(45)31-33(43)29-26(18-37(31,8)19-38(30,39)9)25(14-15-27(29)41)24-12-10-23(11-13-24)16-21(3)17-36(5,6)7/h10-15,20,28,30-31,41,46H,3,16-19H2,1-2,4-9H3/t28?,30?,31?,37-,38-,39+/m1/s1 |
| InChIKey | LAJJIVSQQHCTEA-CZHPUPTFSA-N |
| XLogP | 6.29 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|