C36H42O7 — CID 123211888
(4aR,5aR,12aR)-2-acetyl-7-(3-ethyl-4-propylphenyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123211888) has the molecular formula C36H42O7 and a molecular weight of 586.73 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-7-(3-ethyl-4-propylphenyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-7-(3-ethyl-4-propylphenyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123211888 |
| Molecular Formula | C36H42O7 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-7-(3-ethyl-4-propylphenyl)-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CCCc1ccc(-c2ccc(O)c3c2C[C@]2(C)C[C@]4(C)C(C(C)C)C(=O)C(C(C)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1CC |
| InChI | InChI=1S/C36H42O7/c1-8-10-21-11-12-22(15-20(21)9-2)23-13-14-25(38)27-24(23)16-34(6)17-35(7)28(18(3)4)30(39)26(19(5)37)32(41)36(35,43)33(42)29(34)31(27)40/h11-15,18,26,28-29,38,43H,8-10,16-17H2,1-7H3/t26?,28?,29?,34-,35-,36+/m1/s1 |
| InChIKey | PCFGFYOJAXOPOI-NYTHNIPISA-N |
| XLogP | 5.27 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|