C33H36O7 — CID 123422596
(4aR,5aR,12aR)-2-acetyl-7-[2-(cyclohexen-1-yl)ethynyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123422596) has the molecular formula C33H36O7 and a molecular weight of 544.64 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-7-[2-(cyclohexen-1-yl)ethynyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-7-[2-(cyclohexen-1-yl)ethynyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123422596 |
| Molecular Formula | C33H36O7 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-7-[2-(cyclohexen-1-yl)ethynyl]-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)C[C@@]3(C)Cc4c(C#CC5=CCCCC5)ccc(O)c4C(=O)C3C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C33H36O7/c1-17(2)25-27(36)23(18(3)34)29(38)33(40)30(39)26-28(37)24-21(15-31(26,4)16-32(25,33)5)20(13-14-22(24)35)12-11-19-9-7-6-8-10-19/h9,13-14,17,23,25-26,35,40H,6-8,10,15-16H2,1-5H3/t23?,25?,26?,31-,32-,33+/m1/s1 |
| InChIKey | QVPMSAGYKBMKFQ-YEQWBUIHSA-N |
| XLogP | 3.94 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|