C35H42O6 — CID 91152138
(4aS,5aS,12aR)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-7-[2-(1-methylcyclohexyl)ethynyl]-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione (PubChem CID 91152138) has the molecular formula C35H42O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is (4aS,5aS,12aR)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-7-[2-(1-methylcyclohexyl)ethynyl]-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione.
| Compound Name | (4aS,5aS,12aR)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-7-[2-(1-methylcyclohexyl)ethynyl]-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 91152138 |
| Molecular Formula | C35H42O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | (4aS,5aS,12aR)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-7-[2-(1-methylcyclohexyl)ethynyl]-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione |
| SMILES | CC(=O)C1C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(C#CC5(C)CCCCC5)c4C[C@@]3(C)C[C@@]2(C)C(C(C)C)=C1C |
| InChI | InChI=1S/C35H42O6/c1-19(2)27-20(3)25(21(4)36)30(39)35(41)31(40)28-29(38)26-23(17-33(28,6)18-34(27,35)7)22(11-12-24(26)37)13-16-32(5)14-9-8-10-15-32/h11-12,19,25,28,37,41H,8-10,14-15,17-18H2,1-7H3/t25?,28?,33-,34-,35+/m0/s1 |
| InChIKey | ILBKMWXEOPPBAX-FXOXGOLPSA-N |
| XLogP | 5.55 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|