C39H48O7 — CID 91585204
(4aS,5aS,12aR)-2-acetyl-7-[5-(2-ethylbutyl)-2-methoxyphenyl]-10,12a-dihydroxy-3,4a,5a-trimethyl-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione (PubChem CID 91585204) has the molecular formula C39H48O7 and a molecular weight of 628.81 g/mol. Its IUPAC name is (4aS,5aS,12aR)-2-acetyl-7-[5-(2-ethylbutyl)-2-methoxyphenyl]-10,12a-dihydroxy-3,4a,5a-trimethyl-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione.
| Compound Name | (4aS,5aS,12aR)-2-acetyl-7-[5-(2-ethylbutyl)-2-methoxyphenyl]-10,12a-dihydroxy-3,4a,5a-trimethyl-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 91585204 |
| Molecular Formula | C39H48O7 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | (4aS,5aS,12aR)-2-acetyl-7-[5-(2-ethylbutyl)-2-methoxyphenyl]-10,12a-dihydroxy-3,4a,5a-trimethyl-4-propan-2-yl-2,5,6,11a-tetrahydrotetracene-1,11,12-trione |
| SMILES | CCC(CC)Cc1ccc(OC)c(-c2ccc(O)c3c2C[C@@]2(C)C[C@@]4(C)C(C(C)C)=C(C)C(C(C)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C39H48O7/c1-10-23(11-2)16-24-12-15-29(46-9)26(17-24)25-13-14-28(41)31-27(25)18-37(7)19-38(8)32(20(3)4)21(5)30(22(6)40)35(43)39(38,45)36(44)33(37)34(31)42/h12-15,17,20,23,30,33,41,45H,10-11,16,18-19H2,1-9H3/t30?,33?,37-,38-,39+/m0/s1 |
| InChIKey | XZBHESZFJBTMRN-IUXPMYPTSA-N |
| XLogP | 6.88 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|