C31H31FN2O9 — CID 91131953
3-[(6aS,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-10a,11a-dimethyl-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-4-methoxybenzoyl fluoride (PubChem CID 91131953) has the molecular formula C31H31FN2O9 and a molecular weight of 594.59 g/mol. Its IUPAC name is 3-[(6aS,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-10a,11a-dimethyl-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-4-methoxybenzoyl fluoride.
| Compound Name | 3-[(6aS,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-10a,11a-dimethyl-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-4-methoxybenzoyl fluoride |
|---|---|
| PubChem CID | 91131953 |
| Molecular Formula | C31H31FN2O9 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 3-[(6aS,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-10a,11a-dimethyl-5,6,7,9-tetraoxo-5a,10,11,12-tetrahydrotetracen-1-yl]-4-methoxybenzoyl fluoride |
| SMILES | COc1ccc(C(=O)F)cc1-c1ccc(O)c2c1C[C@@]1(C)C[C@@]3(C)[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H31FN2O9/c1-29-11-16-14(15-10-13(27(32)40)6-9-18(15)43-5)7-8-17(35)19(16)22(36)21(29)26(39)31(42)25(38)20(28(33)41)23(37)24(34(3)4)30(31,2)12-29/h6-10,20-21,24,35,42H,11-12H2,1-5H3,(H2,33,41)/t20?,21?,24-,29+,30+,31-/m1/s1 |
| InChIKey | GYTKWITUWFKZLI-JZLLZMORSA-N |
| XLogP | 1.43 |
| TPSA | 181.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|