C36H41NO7 — CID 91549159
N-[[(5aS,6aS,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-phenyl-7-propan-2-yl-5,6,9,11a-tetrahydrotetracen-2-yl]methyl]propanamide (PubChem CID 91549159) has the molecular formula C36H41NO7 and a molecular weight of 599.72 g/mol. Its IUPAC name is N-[[(5aS,6aS,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-phenyl-7-propan-2-yl-5,6,9,11a-tetrahydrotetracen-2-yl]methyl]propanamide.
| Compound Name | N-[[(5aS,6aS,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-phenyl-7-propan-2-yl-5,6,9,11a-tetrahydrotetracen-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 91549159 |
| Molecular Formula | C36H41NO7 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | N-[[(5aS,6aS,10aR)-9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-phenyl-7-propan-2-yl-5,6,9,11a-tetrahydrotetracen-2-yl]methyl]propanamide |
| SMILES | CCC(=O)NCc1cc(-c2ccccc2)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(C)=O)C(C)=C(C(C)C)[C@]3(C)C[C@]1(C)C2 |
| InChI | InChI=1S/C36H41NO7/c1-8-25(39)37-16-22-14-23(21-12-10-9-11-13-21)24-15-34(6)17-35(7)28(18(2)3)19(4)26(20(5)38)32(42)36(35,44)33(43)29(34)31(41)27(24)30(22)40/h9-14,18,26,29,40,44H,8,15-17H2,1-7H3,(H,37,39)/t26?,29?,34-,35-,36+/m0/s1 |
| InChIKey | YMJYASTYTGEHHP-AJMXZJAFSA-N |
| XLogP | 4.92 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|