C37H42O7 — CID 91146129
(4R,4aS,5aS,12aS)-2-acetyl-9-(4-acetylphenyl)-10,12a-dihydroxy-3,4a,5a-trimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione (PubChem CID 91146129) has the molecular formula C37H42O7 and a molecular weight of 598.74 g/mol. Its IUPAC name is (4R,4aS,5aS,12aS)-2-acetyl-9-(4-acetylphenyl)-10,12a-dihydroxy-3,4a,5a-trimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione.
| Compound Name | (4R,4aS,5aS,12aS)-2-acetyl-9-(4-acetylphenyl)-10,12a-dihydroxy-3,4a,5a-trimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 91146129 |
| Molecular Formula | C37H42O7 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (4R,4aS,5aS,12aS)-2-acetyl-9-(4-acetylphenyl)-10,12a-dihydroxy-3,4a,5a-trimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
| SMILES | CC(=O)C1=C(C)[C@@H](C(C)C)[C@]2(C)C[C@]3(C)Cc4c(C(C)C)cc(-c5ccc(C(C)=O)cc5)c(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C37H42O7/c1-17(2)24-14-25(23-12-10-22(11-13-23)20(6)38)31(40)28-26(24)15-35(8)16-36(9)29(18(3)4)19(5)27(21(7)39)33(42)37(36,44)34(43)30(35)32(28)41/h10-14,17-18,29-30,40,44H,15-16H2,1-9H3/t29-,30?,35+,36+,37-/m1/s1 |
| InChIKey | BJLRCVYPIXOWPT-XQCHEOPASA-N |
| XLogP | 6.22 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|