C38H44O6 — CID 90960763
(4R,4aS,5aS,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-9-[2-(4-methylphenyl)ethenyl]-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione (PubChem CID 90960763) has the molecular formula C38H44O6 and a molecular weight of 596.76 g/mol. Its IUPAC name is (4R,4aS,5aS,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-9-[2-(4-methylphenyl)ethenyl]-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione.
| Compound Name | (4R,4aS,5aS,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-9-[2-(4-methylphenyl)ethenyl]-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 90960763 |
| Molecular Formula | C38H44O6 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | (4R,4aS,5aS,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5a-trimethyl-9-[2-(4-methylphenyl)ethenyl]-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
| SMILES | CC(=O)C1=C(C)[C@@H](C(C)C)[C@]2(C)C[C@]3(C)Cc4c(C(C)C)cc(C=Cc5ccc(C)cc5)c(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C38H44O6/c1-19(2)26-16-25(15-14-24-12-10-21(5)11-13-24)32(40)29-27(26)17-36(8)18-37(9)30(20(3)4)22(6)28(23(7)39)34(42)38(37,44)35(43)31(36)33(29)41/h10-16,19-20,30-31,40,44H,17-18H2,1-9H3/t30-,31?,36+,37+,38-/m1/s1 |
| InChIKey | ULOGSWANKZLPTI-PTMUELFOSA-N |
| XLogP | 6.83 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|