C38H44O3 — CID 123213159
2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-[2-(4-methylphenyl)ethenyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 123213159) has the molecular formula C38H44O3 and a molecular weight of 548.77 g/mol. Its IUPAC name is 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-[2-(4-methylphenyl)ethenyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-[2-(4-methylphenyl)ethenyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 123213159 |
| Molecular Formula | C38H44O3 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-[2-(4-methylphenyl)ethenyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)Cc4c(C(C)C)cc(C=Cc5ccc(C)cc5)c(C)c4C(=O)C3=C(C)C2(C)C1=O |
| InChI | InChI=1S/C38H44O3/c1-21(2)29-17-28(16-15-27-13-11-22(3)12-14-27)24(5)32-30(29)19-36(8)20-37(9)18-23(4)31(26(7)39)35(41)38(37,10)25(6)33(36)34(32)40/h11-17,21H,18-20H2,1-10H3 |
| InChIKey | NVDIWRBFTIAGGZ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|