C36H42O3 — CID 118015841
2-acetyl-7-(4-tert-butylphenyl)-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 118015841) has the molecular formula C36H42O3 and a molecular weight of 522.73 g/mol. Its IUPAC name is 2-acetyl-7-(4-tert-butylphenyl)-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-7-(4-tert-butylphenyl)-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015841 |
| Molecular Formula | C36H42O3 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 2-acetyl-7-(4-tert-butylphenyl)-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)Cc4c(-c5ccc(C(C)(C)C)cc5)ccc(C)c4C(=O)C3=C(C)C2(C)C1=O |
| InChI | InChI=1S/C36H42O3/c1-20-11-16-26(24-12-14-25(15-13-24)33(5,6)7)27-18-34(8)19-35(9)17-21(2)28(23(4)37)32(39)36(35,10)22(3)30(34)31(38)29(20)27/h11-16H,17-19H2,1-10H3 |
| InChIKey | ALMCHUVBJXLLMH-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|