C32H40O8 — CID 123708548
2-methylpropyl 2-(9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl)acetate (PubChem CID 123708548) has the molecular formula C32H40O8 and a molecular weight of 552.66 g/mol. Its IUPAC name is 2-methylpropyl 2-(9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl)acetate.
| Compound Name | 2-methylpropyl 2-(9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl)acetate |
|---|---|
| PubChem CID | 123708548 |
| Molecular Formula | C32H40O8 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 2-methylpropyl 2-(9-acetyl-1,10a-dihydroxy-5a,6a,8-trimethyl-10,11,12-trioxo-4-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl)acetate |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)Cc4c(C(C)C)cc(CC(=O)OCC(C)C)c(O)c4C(=O)C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C32H40O8/c1-15(2)13-40-22(34)10-19-9-20(16(3)4)21-12-30(7)14-31(8)11-17(5)23(18(6)33)28(37)32(31,39)29(38)25(30)27(36)24(21)26(19)35/h9,15-16,25,35,39H,10-14H2,1-8H3 |
| InChIKey | MMVBJMWBGDNTCN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|